C14H19BF2O5S — CID 174985042
[3-(difluoromethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl] propanoate (PubChem CID 174985042) has the molecular formula C14H19BF2O5S and a molecular weight of 348.18 g/mol. Its IUPAC name is [3-(difluoromethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl] propanoate.
| Compound Name | [3-(difluoromethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl] propanoate |
|---|---|
| PubChem CID | 174985042 |
| Molecular Formula | C14H19BF2O5S |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | [3-(difluoromethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl] propanoate |
| SMILES | CCC(=O)Oc1sc(B2OC(C)(C)C(C)(C)O2)cc1OC(F)F |
| InChI | InChI=1S/C14H19BF2O5S/c1-6-10(18)20-11-8(19-12(16)17)7-9(23-11)15-21-13(2,3)14(4,5)22-15/h7,12H,6H2,1-5H3 |
| InChIKey | NNNLWAPCPHQTJG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|