C11H7F13O2 — CID 174985970
ethyl 4,4,5,5,6,6,6-heptafluoro-2-methylidene-3,3-bis(trifluoromethyl)hexanoate (PubChem CID 174985970) has the molecular formula C11H7F13O2 and a molecular weight of 418.15 g/mol. Its IUPAC name is ethyl 4,4,5,5,6,6,6-heptafluoro-2-methylidene-3,3-bis(trifluoromethyl)hexanoate.
| Compound Name | ethyl 4,4,5,5,6,6,6-heptafluoro-2-methylidene-3,3-bis(trifluoromethyl)hexanoate |
|---|---|
| PubChem CID | 174985970 |
| Molecular Formula | C11H7F13O2 |
| Molecular Weight | 418.15 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | ethyl 4,4,5,5,6,6,6-heptafluoro-2-methylidene-3,3-bis(trifluoromethyl)hexanoate |
| SMILES | C=C(C(=O)OCC)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F13O2/c1-3-26-5(25)4(2)6(9(16,17)18,10(19,20)21)7(12,13)8(14,15)11(22,23)24/h2-3H2,1H3 |
| InChIKey | HSRCITREGBUMCL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.15 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|