C11H13F7O2 — CID 174985971
ethyl 4,4,5,5,6,6,6-heptafluoro-3,3-dimethyl-2-methylidenehexanoate (PubChem CID 174985971) has the molecular formula C11H13F7O2 and a molecular weight of 310.21 g/mol. Its IUPAC name is ethyl 4,4,5,5,6,6,6-heptafluoro-3,3-dimethyl-2-methylidenehexanoate.
| Compound Name | ethyl 4,4,5,5,6,6,6-heptafluoro-3,3-dimethyl-2-methylidenehexanoate |
|---|---|
| PubChem CID | 174985971 |
| Molecular Formula | C11H13F7O2 |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | ethyl 4,4,5,5,6,6,6-heptafluoro-3,3-dimethyl-2-methylidenehexanoate |
| SMILES | C=C(C(=O)OCC)C(C)(C)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F7O2/c1-5-20-7(19)6(2)8(3,4)9(12,13)10(14,15)11(16,17)18/h2,5H2,1,3-4H3 |
| InChIKey | SWQQWANSKOXOCF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|