C6H15N3O — CID 174987028
1,3,5-trimethyl-1,3,5-triazinan-2-ol (PubChem CID 174987028) has the molecular formula C6H15N3O and a molecular weight of 145.21 g/mol. Its IUPAC name is 1,3,5-trimethyl-1,3,5-triazinan-2-ol.
| Compound Name | 1,3,5-trimethyl-1,3,5-triazinan-2-ol |
|---|---|
| PubChem CID | 174987028 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 1,3,5-trimethyl-1,3,5-triazinan-2-ol |
| SMILES | CN1CN(C)C(O)N(C)C1 |
| InChI | InChI=1S/C6H15N3O/c1-7-4-8(2)6(10)9(3)5-7/h6,10H,4-5H2,1-3H3 |
| InChIKey | UUAAXTYTWXKOJT-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |