About 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid
4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid (PubChem CID 174987053) has the molecular formula C12H15NO7S
and a molecular weight of 317.32 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid |
| PubChem CID | 174987053 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid |
| SMILES | O=C1C=CC(=O)N1CC1CCC(C(=O)O)(S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C12H15NO7S/c14-9-1-2-10(15)13(9)7-8-3-5-12(6-4-8,11(16)17)21(18,19)20/h1-2,8H,3-7H2,(H,16,17)(H,18,19,20) |
| InChIKey | RJWSLVRKQJBAIC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid?
The IUPAC name of 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid (CID 174987053) is 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid is O=C1C=CC(=O)N1CC1CCC(C(=O)O)(S(=O)(=O)O)CC1.
What is the InChIKey of 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid?
The InChIKey is RJWSLVRKQJBAIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO7S/c14-9-1-2-10(15)13(9)7-8-3-5-12(6-4-8,11(16)17)21(18,19)20/h1-2,8H,3-7H2,(H,16,17)(H,18,19,20).
What are the key properties of 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid?
4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid has a molecular weight of 317.32 g/mol, XLogP of -0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dioxopyrrol-1-yl)methyl]-1-sulfocyclohexane-1-carboxylic acid is sourced from PubChem (CID 174987053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).