About (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid
(4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid (PubChem CID 174987996) has the molecular formula C19H22BrNO4
and a molecular weight of 408.29 g/mol. Its IUPAC name is (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid.
Molecular Properties
| Compound Name | (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid |
| PubChem CID | 174987996 |
| Molecular Formula | C19H22BrNO4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid |
| SMILES | CC(=O)Oc1ccc(Br)cc1.CCN(C)c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C11H15NO2.C8H7BrO2/c1-3-12(2)10-6-4-9(5-7-10)8-11(13)14;1-6(10)11-8-4-2-7(9)3-5-8/h4-7H,3,8H2,1-2H3,(H,13,14);2-5H,1H3 |
| InChIKey | VJKUELWYKZTMMV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid?
The IUPAC name of (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid (CID 174987996) is (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid.
What is the SMILES notation for (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid?
The canonical SMILES for (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid is CC(=O)Oc1ccc(Br)cc1.CCN(C)c1ccc(CC(=O)O)cc1.
What is the InChIKey of (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid?
The InChIKey is VJKUELWYKZTMMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C8H7BrO2/c1-3-12(2)10-6-4-9(5-7-10)8-11(13)14;1-6(10)11-8-4-2-7(9)3-5-8/h4-7H,3,8H2,1-2H3,(H,13,14);2-5H,1H3.
What are the key properties of (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid?
(4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid has a molecular weight of 408.29 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl) acetate;2-[4-[ethyl(methyl)amino]phenyl]acetic acid is sourced from PubChem (CID 174987996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).