About azane;2-bromo-1-propylpiperidine
azane;2-bromo-1-propylpiperidine (PubChem CID 174988574) has the molecular formula C8H19BrN2
and a molecular weight of 223.16 g/mol. Its IUPAC name is azane;2-bromo-1-propylpiperidine.
Molecular Properties
| Compound Name | azane;2-bromo-1-propylpiperidine |
| PubChem CID | 174988574 |
| Molecular Formula | C8H19BrN2 |
| Molecular Weight | 223.16 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | azane;2-bromo-1-propylpiperidine |
| SMILES | CCCN1CCCCC1Br.N |
| InChI | InChI=1S/C8H16BrN.H3N/c1-2-6-10-7-4-3-5-8(10)9;/h8H,2-7H2,1H3;1H3 |
| InChIKey | LAAAGAOGCVBCMK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze azane;2-bromo-1-propylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-bromo-1-propylpiperidine?
The IUPAC name of azane;2-bromo-1-propylpiperidine (CID 174988574) is azane;2-bromo-1-propylpiperidine.
What is the SMILES notation for azane;2-bromo-1-propylpiperidine?
The canonical SMILES for azane;2-bromo-1-propylpiperidine is CCCN1CCCCC1Br.N.
What is the InChIKey of azane;2-bromo-1-propylpiperidine?
The InChIKey is LAAAGAOGCVBCMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16BrN.H3N/c1-2-6-10-7-4-3-5-8(10)9;/h8H,2-7H2,1H3;1H3.
What are the key properties of azane;2-bromo-1-propylpiperidine?
azane;2-bromo-1-propylpiperidine has a molecular weight of 223.16 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-bromo-1-propylpiperidine is sourced from PubChem (CID 174988574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).