C15H17Cl2N3O3 — CID 174988664
ethyl 2,6-dichloro-6-[(1,3-dimethylpyrazole-4-carbonyl)amino]cyclohexa-2,4-diene-1-carboxylate (PubChem CID 174988664) has the molecular formula C15H17Cl2N3O3 and a molecular weight of 358.23 g/mol. Its IUPAC name is ethyl 2,6-dichloro-6-[(1,3-dimethylpyrazole-4-carbonyl)amino]cyclohexa-2,4-diene-1-carboxylate.
| Compound Name | ethyl 2,6-dichloro-6-[(1,3-dimethylpyrazole-4-carbonyl)amino]cyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 174988664 |
| Molecular Formula | C15H17Cl2N3O3 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | ethyl 2,6-dichloro-6-[(1,3-dimethylpyrazole-4-carbonyl)amino]cyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1C(Cl)=CC=CC1(Cl)NC(=O)c1cn(C)nc1C |
| InChI | InChI=1S/C15H17Cl2N3O3/c1-4-23-14(22)12-11(16)6-5-7-15(12,17)18-13(21)10-8-20(3)19-9(10)2/h5-8,12H,4H2,1-3H3,(H,18,21) |
| InChIKey | KYGSDJWJMJJZIW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|