About N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene
N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene (PubChem CID 174988717) has the molecular formula C20H18F2N2O
and a molecular weight of 340.37 g/mol. Its IUPAC name is N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene.
Molecular Properties
| Compound Name | N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene |
| PubChem CID | 174988717 |
| Molecular Formula | C20H18F2N2O |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene |
| SMILES | CCNC(=O)c1ccc(-c2ccc(F)cc2)cn1.Fc1ccccc1 |
| InChI | InChI=1S/C14H13FN2O.C6H5F/c1-2-16-14(18)13-8-5-11(9-17-13)10-3-6-12(15)7-4-10;7-6-4-2-1-3-5-6/h3-9H,2H2,1H3,(H,16,18);1-5H |
| InChIKey | PUAYSYGXXSMMNC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene?
The IUPAC name of N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene (CID 174988717) is N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene.
What is the SMILES notation for N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene?
The canonical SMILES for N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene is CCNC(=O)c1ccc(-c2ccc(F)cc2)cn1.Fc1ccccc1.
What is the InChIKey of N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene?
The InChIKey is PUAYSYGXXSMMNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2O.C6H5F/c1-2-16-14(18)13-8-5-11(9-17-13)10-3-6-12(15)7-4-10;7-6-4-2-1-3-5-6/h3-9H,2H2,1H3,(H,16,18);1-5H.
What are the key properties of N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene?
N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene has a molecular weight of 340.37 g/mol, XLogP of 4.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-(4-fluorophenyl)pyridine-2-carboxamide;fluorobenzene is sourced from PubChem (CID 174988717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).