C6H12NNa3O6 — CID 174988964
trisodium;2-(1-carboxyethylamino)propanedioic acid;hydride (PubChem CID 174988964) has the molecular formula C6H12NNa3O6 and a molecular weight of 263.13 g/mol. Its IUPAC name is trisodium;2-(1-carboxyethylamino)propanedioic acid;hydride.
| Compound Name | trisodium;2-(1-carboxyethylamino)propanedioic acid;hydride |
|---|---|
| PubChem CID | 174988964 |
| Molecular Formula | C6H12NNa3O6 |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | trisodium;2-(1-carboxyethylamino)propanedioic acid;hydride |
| SMILES | CC(NC(C(=O)O)C(=O)O)C(=O)O.[H-].[H-].[H-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H9NO6.3Na.3H/c1-2(4(8)9)7-3(5(10)11)6(12)13;;;;;;/h2-3,7H,1H3,(H,8,9)(H,10,11)(H,12,13);;;;;;/q;3*+1;3*-1 |
| InChIKey | TVEKDJAUWXCYIO-UHFFFAOYSA-N |
| XLogP | -10.06 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | -10.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|