C23H32O8 — CID 174989073
2-methylpropane-1,3-diol;2,3,4,5-tetrakis(oxiran-2-ylmethyl)benzoic acid (PubChem CID 174989073) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-methylpropane-1,3-diol;2,3,4,5-tetrakis(oxiran-2-ylmethyl)benzoic acid.
| Compound Name | 2-methylpropane-1,3-diol;2,3,4,5-tetrakis(oxiran-2-ylmethyl)benzoic acid |
|---|---|
| PubChem CID | 174989073 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-methylpropane-1,3-diol;2,3,4,5-tetrakis(oxiran-2-ylmethyl)benzoic acid |
| SMILES | CC(CO)CO.O=C(O)c1cc(CC2CO2)c(CC2CO2)c(CC2CO2)c1CC1CO1 |
| InChI | InChI=1S/C19H22O6.C4H10O2/c20-19(21)18-2-10(1-11-6-22-11)15(3-12-7-23-12)16(4-13-8-24-13)17(18)5-14-9-25-14;1-4(2-5)3-6/h2,11-14H,1,3-9H2,(H,20,21);4-6H,2-3H2,1H3 |
| InChIKey | ZBGSNIDKYVIYRO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|