C9H13Cl2N3O2 — CID 174989220
6-chloro-3-piperidin-4-yl-1H-pyrimidine-2,4-dione;hydrochloride (PubChem CID 174989220) has the molecular formula C9H13Cl2N3O2 and a molecular weight of 266.13 g/mol. Its IUPAC name is 6-chloro-3-piperidin-4-yl-1H-pyrimidine-2,4-dione;hydrochloride.
| Compound Name | 6-chloro-3-piperidin-4-yl-1H-pyrimidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 174989220 |
| Molecular Formula | C9H13Cl2N3O2 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 6-chloro-3-piperidin-4-yl-1H-pyrimidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=c1cc(Cl)[nH]c(=O)n1C1CCNCC1 |
| InChI | InChI=1S/C9H12ClN3O2.ClH/c10-7-5-8(14)13(9(15)12-7)6-1-3-11-4-2-6;/h5-6,11H,1-4H2,(H,12,15);1H |
| InChIKey | WSSAEFMQMIATNK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |