About dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane
dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane (PubChem CID 174989283) has the molecular formula C23H27NOSi2
and a molecular weight of 389.65 g/mol. Its IUPAC name is dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane.
Molecular Properties
| Compound Name | dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane |
| PubChem CID | 174989283 |
| Molecular Formula | C23H27NOSi2 |
| Molecular Weight | 389.65 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane |
| SMILES | C[Si](C)(N1CCOC1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27NOSi2/c1-26(2,24-18-19-25-20-24)27(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17H,18-20H2,1-2H3 |
| InChIKey | YEEWSYRAEMEWMP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane?
The IUPAC name of dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane (CID 174989283) is dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane.
What is the SMILES notation for dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane?
The canonical SMILES for dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane is C[Si](C)(N1CCOC1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane?
The InChIKey is YEEWSYRAEMEWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NOSi2/c1-26(2,24-18-19-25-20-24)27(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17H,18-20H2,1-2H3.
What are the key properties of dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane?
dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane has a molecular weight of 389.65 g/mol, XLogP of 2.73, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(1,3-oxazolidin-3-yl)-triphenylsilylsilane is sourced from PubChem (CID 174989283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).