About [methoxy(phenyl)boranyl] formate
[methoxy(phenyl)boranyl] formate (PubChem CID 174989602) has the molecular formula C8H9BO3
and a molecular weight of 163.97 g/mol. Its IUPAC name is [methoxy(phenyl)boranyl] formate.
Molecular Properties
| Compound Name | [methoxy(phenyl)boranyl] formate |
| PubChem CID | 174989602 |
| Molecular Formula | C8H9BO3 |
| Molecular Weight | 163.97 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | [methoxy(phenyl)boranyl] formate |
| SMILES | COB(OC=O)c1ccccc1 |
| InChI | InChI=1S/C8H9BO3/c1-11-9(12-7-10)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | NAVOUWYMAJEYKV-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.97 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [methoxy(phenyl)boranyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methoxy(phenyl)boranyl] formate?
The IUPAC name of [methoxy(phenyl)boranyl] formate (CID 174989602) is [methoxy(phenyl)boranyl] formate.
What is the SMILES notation for [methoxy(phenyl)boranyl] formate?
The canonical SMILES for [methoxy(phenyl)boranyl] formate is COB(OC=O)c1ccccc1.
What is the InChIKey of [methoxy(phenyl)boranyl] formate?
The InChIKey is NAVOUWYMAJEYKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BO3/c1-11-9(12-7-10)8-5-3-2-4-6-8/h2-7H,1H3.
What are the key properties of [methoxy(phenyl)boranyl] formate?
[methoxy(phenyl)boranyl] formate has a molecular weight of 163.97 g/mol, XLogP of 0.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [methoxy(phenyl)boranyl] formate is sourced from PubChem (CID 174989602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).