C17H19F17OSi — CID 174989694
6-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)-2,2,6-trimethyloxasilinane (PubChem CID 174989694) has the molecular formula C17H19F17OSi and a molecular weight of 590.39 g/mol. Its IUPAC name is 6-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)-2,2,6-trimethyloxasilinane.
| Compound Name | 6-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)-2,2,6-trimethyloxasilinane |
|---|---|
| PubChem CID | 174989694 |
| Molecular Formula | C17H19F17OSi |
| Molecular Weight | 590.39 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | 6-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)-2,2,6-trimethyloxasilinane |
| SMILES | CC1(C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F)CCC[Si](C)(C)O1 |
| InChI | InChI=1S/C17H19F17OSi/c1-11(5-4-6-36(2,3)35-11)10(22)13(25,26)15(29,30)17(33,34)16(31,32)14(27,28)12(23,24)8(19)7(18)9(20)21/h7-10H,4-6H2,1-3H3 |
| InChIKey | RJSAAAMPCJADGP-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.39 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|