About 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde
5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde (PubChem CID 174989730) has the molecular formula C18H18N4OS
and a molecular weight of 338.44 g/mol. Its IUPAC name is 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde |
| PubChem CID | 174989730 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde |
| SMILES | CCc1nnc(N)s1.Cn1c2ccccc2c2cc(C=O)ccc21 |
| InChI | InChI=1S/C14H11NO.C4H7N3S/c1-15-13-5-3-2-4-11(13)12-8-10(9-16)6-7-14(12)15;1-2-3-6-7-4(5)8-3/h2-9H,1H3;2H2,1H3,(H2,5,7) |
| InChIKey | ZKUPNHRFIGIMQJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde?
The IUPAC name of 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde (CID 174989730) is 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde.
What is the SMILES notation for 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde?
The canonical SMILES for 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde is CCc1nnc(N)s1.Cn1c2ccccc2c2cc(C=O)ccc21.
What is the InChIKey of 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde?
The InChIKey is ZKUPNHRFIGIMQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO.C4H7N3S/c1-15-13-5-3-2-4-11(13)12-8-10(9-16)6-7-14(12)15;1-2-3-6-7-4(5)8-3/h2-9H,1H3;2H2,1H3,(H2,5,7).
What are the key properties of 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde?
5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde has a molecular weight of 338.44 g/mol, XLogP of 3.83, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3,4-thiadiazol-2-amine;9-methylcarbazole-3-carbaldehyde is sourced from PubChem (CID 174989730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).