C15H21N7O5 — CID 174989862
2-[[2-[ethyl(methyl)amino]acetyl]amino]-3-[2-(2-methyl-5-nitroimidazol-1-yl)-1H-imidazol-5-yl]propanoic acid (PubChem CID 174989862) has the molecular formula C15H21N7O5 and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-[[2-[ethyl(methyl)amino]acetyl]amino]-3-[2-(2-methyl-5-nitroimidazol-1-yl)-1H-imidazol-5-yl]propanoic acid.
| Compound Name | 2-[[2-[ethyl(methyl)amino]acetyl]amino]-3-[2-(2-methyl-5-nitroimidazol-1-yl)-1H-imidazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 174989862 |
| Molecular Formula | C15H21N7O5 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[[2-[ethyl(methyl)amino]acetyl]amino]-3-[2-(2-methyl-5-nitroimidazol-1-yl)-1H-imidazol-5-yl]propanoic acid |
| SMILES | CCN(C)CC(=O)NC(Cc1cnc(-n2c([N+](=O)[O-])cnc2C)[nH]1)C(=O)O |
| InChI | InChI=1S/C15H21N7O5/c1-4-20(3)8-12(23)19-11(14(24)25)5-10-6-17-15(18-10)21-9(2)16-7-13(21)22(26)27/h6-7,11H,4-5,8H2,1-3H3,(H,17,18)(H,19,23)(H,24,25) |
| InChIKey | ULBIKMCUISGEHJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 159.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|