About (4-acetamidophenyl) acetate
(4-acetamidophenyl) acetate (PubChem CID 17499) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is (4-acetamidophenyl) acetate.
Molecular Properties
| Compound Name | (4-acetamidophenyl) acetate |
| PubChem CID | 17499 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (4-acetamidophenyl) acetate |
| SMILES | CC(=O)Nc1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C10H11NO3/c1-7(12)11-9-3-5-10(6-4-9)14-8(2)13/h3-6H,1-2H3,(H,11,12) |
| InChIKey | UJAOSPFULOFZRR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) acetate?
The IUPAC name of (4-acetamidophenyl) acetate (CID 17499) is (4-acetamidophenyl) acetate.
What is the SMILES notation for (4-acetamidophenyl) acetate?
The canonical SMILES for (4-acetamidophenyl) acetate is CC(=O)Nc1ccc(OC(C)=O)cc1.
What is the InChIKey of (4-acetamidophenyl) acetate?
The InChIKey is UJAOSPFULOFZRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-7(12)11-9-3-5-10(6-4-9)14-8(2)13/h3-6H,1-2H3,(H,11,12).
What are the key properties of (4-acetamidophenyl) acetate?
(4-acetamidophenyl) acetate has a molecular weight of 193.20 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) acetate is sourced from PubChem (CID 17499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).