About (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride
(Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride (PubChem CID 174990439) has the molecular formula C22H44ClNO2
and a molecular weight of 390.05 g/mol. Its IUPAC name is (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride.
Molecular Properties
| Compound Name | (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride |
| PubChem CID | 174990439 |
| Molecular Formula | C22H44ClNO2 |
| Molecular Weight | 390.05 g/mol |
| Exact Mass | 389.31 |
| IUPAC Name | (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride |
| SMILES | CCCCCCCC/C=C\CCCCCCC(C(=O)N(C)C)C(C)O.Cl |
| InChI | InChI=1S/C22H43NO2.ClH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(20(2)24)22(25)23(3)4;/h12-13,20-21,24H,5-11,14-19H2,1-4H3;1H/b13-12-; |
| InChIKey | ZHIHHXPKRCWBBG-USGGBSEESA-N |
| XLogP | 6.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.05 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride?
The IUPAC name of (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride (CID 174990439) is (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride.
What is the SMILES notation for (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride?
The canonical SMILES for (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride is CCCCCCCC/C=C\CCCCCCC(C(=O)N(C)C)C(C)O.Cl.
What is the InChIKey of (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride?
The InChIKey is ZHIHHXPKRCWBBG-USGGBSEESA-N. The full InChI is InChI=1S/C22H43NO2.ClH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(20(2)24)22(25)23(3)4;/h12-13,20-21,24H,5-11,14-19H2,1-4H3;1H/b13-12-;.
What are the key properties of (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride?
(Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride has a molecular weight of 390.05 g/mol, XLogP of 6.14, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide;hydrochloride is sourced from PubChem (CID 174990439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).