About 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole
3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole (PubChem CID 174990780) has the molecular formula C10H9F6N3O2
and a molecular weight of 317.19 g/mol. Its IUPAC name is 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole.
Molecular Properties
| Compound Name | 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole |
| PubChem CID | 174990780 |
| Molecular Formula | C10H9F6N3O2 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole |
| SMILES | Cn1ccnc1.O=C1CC(C(F)(F)F)(C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C6H3F6NO2.C4H6N2/c7-5(8,9)4(6(10,11)12)1-2(14)13-3(4)15;1-6-3-2-5-4-6/h1H2,(H,13,14,15);2-4H,1H3 |
| InChIKey | DGLJZOZNWBEUSV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole?
The IUPAC name of 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole (CID 174990780) is 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole.
What is the SMILES notation for 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole?
The canonical SMILES for 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole is Cn1ccnc1.O=C1CC(C(F)(F)F)(C(F)(F)F)C(=O)N1.
What is the InChIKey of 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole?
The InChIKey is DGLJZOZNWBEUSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F6NO2.C4H6N2/c7-5(8,9)4(6(10,11)12)1-2(14)13-3(4)15;1-6-3-2-5-4-6/h1H2,(H,13,14,15);2-4H,1H3.
What are the key properties of 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole?
3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole has a molecular weight of 317.19 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(trifluoromethyl)pyrrolidine-2,5-dione;1-methylimidazole is sourced from PubChem (CID 174990780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).