About 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine
1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine (PubChem CID 174990905) has the molecular formula C20H20N4O2S
and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine |
| PubChem CID | 174990905 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine |
| SMILES | CCn1c2ccc(C(C)=O)cc2c2cc(C(C)=O)ccc21.Nc1nncs1 |
| InChI | InChI=1S/C18H17NO2.C2H3N3S/c1-4-19-17-7-5-13(11(2)20)9-15(17)16-10-14(12(3)21)6-8-18(16)19;3-2-5-4-1-6-2/h5-10H,4H2,1-3H3;1H,(H2,3,5) |
| InChIKey | ITMNRGHOVYEKCV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine?
The IUPAC name of 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine (CID 174990905) is 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine?
The canonical SMILES for 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine is CCn1c2ccc(C(C)=O)cc2c2cc(C(C)=O)ccc21.Nc1nncs1.
What is the InChIKey of 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine?
The InChIKey is ITMNRGHOVYEKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2.C2H3N3S/c1-4-19-17-7-5-13(11(2)20)9-15(17)16-10-14(12(3)21)6-8-18(16)19;3-2-5-4-1-6-2/h5-10H,4H2,1-3H3;1H,(H2,3,5).
What are the key properties of 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine?
1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine has a molecular weight of 380.47 g/mol, XLogP of 4.34, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-acetyl-9-ethylcarbazol-3-yl)ethanone;1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 174990905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).