About 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide
2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide (PubChem CID 17499096) has the molecular formula C12H10F3N5O3
and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide.
Molecular Properties
| Compound Name | 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide |
| PubChem CID | 17499096 |
| Molecular Formula | C12H10F3N5O3 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)NNC(=O)c1ccc[nH]c1=O |
| InChI | InChI=1S/C12H10F3N5O3/c13-12(14,15)8-3-5-20(19-8)6-9(21)17-18-11(23)7-2-1-4-16-10(7)22/h1-5H,6H2,(H,16,22)(H,17,21)(H,18,23) |
| InChIKey | CXDVJTPENOYXMO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide?
The IUPAC name of 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide (CID 17499096) is 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide.
What is the SMILES notation for 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide?
The canonical SMILES for 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide is O=C(Cn1ccc(C(F)(F)F)n1)NNC(=O)c1ccc[nH]c1=O.
What is the InChIKey of 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide?
The InChIKey is CXDVJTPENOYXMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3N5O3/c13-12(14,15)8-3-5-20(19-8)6-9(21)17-18-11(23)7-2-1-4-16-10(7)22/h1-5H,6H2,(H,16,22)(H,17,21)(H,18,23).
What are the key properties of 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide?
2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide has a molecular weight of 329.24 g/mol, XLogP of 0.05, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]-1H-pyridine-3-carbohydrazide is sourced from PubChem (CID 17499096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).