C16H24BN4O6 — CID 174991169
CID 174991169 (PubChem CID 174991169) has the molecular formula C16H24BN4O6 and a molecular weight of 379.20 g/mol.
| Compound Name | CID 174991169 |
|---|---|
| PubChem CID | 174991169 |
| Molecular Formula | C16H24BN4O6 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | — |
| SMILES | CC(C)CC(NC(=O)c1cnccn1)C(=O)N1CCC[C@H]1C(=O)O.O[B]O |
| InChI | InChI=1S/C16H22N4O4.BH2O2/c1-10(2)8-11(19-14(21)12-9-17-5-6-18-12)15(22)20-7-3-4-13(20)16(23)24;2-1-3/h5-6,9-11,13H,3-4,7-8H2,1-2H3,(H,19,21)(H,23,24);2-3H/t11?,13-;/m0./s1 |
| InChIKey | LOLBSCRRMKCBBX-IYWIJXFJSA-N |
| XLogP | -0.80 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|