C18H16N2O5S — CID 174991174
(2-oxo-5-sulfanylidenepyrrolidin-1-yl) 4-[2-(2,5-dioxopyrrol-1-yl)phenyl]butanoate (PubChem CID 174991174) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is (2-oxo-5-sulfanylidenepyrrolidin-1-yl) 4-[2-(2,5-dioxopyrrol-1-yl)phenyl]butanoate.
| Compound Name | (2-oxo-5-sulfanylidenepyrrolidin-1-yl) 4-[2-(2,5-dioxopyrrol-1-yl)phenyl]butanoate |
|---|---|
| PubChem CID | 174991174 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (2-oxo-5-sulfanylidenepyrrolidin-1-yl) 4-[2-(2,5-dioxopyrrol-1-yl)phenyl]butanoate |
| SMILES | O=C(CCCc1ccccc1N1C(=O)C=CC1=O)ON1C(=O)CCC1=S |
| InChI | InChI=1S/C18H16N2O5S/c21-14-8-9-15(22)19(14)13-6-2-1-4-12(13)5-3-7-18(24)25-20-16(23)10-11-17(20)26/h1-2,4,6,8-9H,3,5,7,10-11H2 |
| InChIKey | PBPQWFKKQSHRRX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|