C22H31ClN4O2S — CID 174991254
N-[1-[(1-amino-2-cyclohexylethyl)amino]-3-(6-chloro-1,3-benzothiazol-2-yl)-1-oxopropan-2-yl]-2-methylpropanamide (PubChem CID 174991254) has the molecular formula C22H31ClN4O2S and a molecular weight of 451.04 g/mol. Its IUPAC name is N-[1-[(1-amino-2-cyclohexylethyl)amino]-3-(6-chloro-1,3-benzothiazol-2-yl)-1-oxopropan-2-yl]-2-methylpropanamide.
| Compound Name | N-[1-[(1-amino-2-cyclohexylethyl)amino]-3-(6-chloro-1,3-benzothiazol-2-yl)-1-oxopropan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 174991254 |
| Molecular Formula | C22H31ClN4O2S |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[1-[(1-amino-2-cyclohexylethyl)amino]-3-(6-chloro-1,3-benzothiazol-2-yl)-1-oxopropan-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(Cc1nc2ccc(Cl)cc2s1)C(=O)NC(N)CC1CCCCC1 |
| InChI | InChI=1S/C22H31ClN4O2S/c1-13(2)21(28)26-17(12-20-25-16-9-8-15(23)11-18(16)30-20)22(29)27-19(24)10-14-6-4-3-5-7-14/h8-9,11,13-14,17,19H,3-7,10,12,24H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | DXILKWKZUYJVSK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|