C6H4Br8 — CID 174991321
1,1,2,2,3,3,4,4-octabromocyclohexane (PubChem CID 174991321) has the molecular formula C6H4Br8 and a molecular weight of 715.33 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octabromocyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4-octabromocyclohexane |
|---|---|
| PubChem CID | 174991321 |
| Molecular Formula | C6H4Br8 |
| Molecular Weight | 715.33 g/mol |
| Exact Mass | 707.38 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octabromocyclohexane |
| SMILES | BrC1(Br)CCC(Br)(Br)C(Br)(Br)C1(Br)Br |
| InChI | InChI=1S/C6H4Br8/c7-3(8)1-2-4(9,10)6(13,14)5(3,11)12/h1-2H2 |
| InChIKey | YFSGZIMHPWFNPJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.33 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|