About selanyl(1,3,5-triazin-2-yl)cyanamide
selanyl(1,3,5-triazin-2-yl)cyanamide (PubChem CID 174991847) has the molecular formula C4H3N5Se
and a molecular weight of 200.06 g/mol. Its IUPAC name is selanyl(1,3,5-triazin-2-yl)cyanamide.
Molecular Properties
| Compound Name | selanyl(1,3,5-triazin-2-yl)cyanamide |
| PubChem CID | 174991847 |
| Molecular Formula | C4H3N5Se |
| Molecular Weight | 200.06 g/mol |
| Exact Mass | 200.96 |
| IUPAC Name | selanyl(1,3,5-triazin-2-yl)cyanamide |
| SMILES | N#CN([SeH])c1ncncn1 |
| InChI | InChI=1S/C4H3N5Se/c5-1-9(10)4-7-2-6-3-8-4/h2-3,10H |
| InChIKey | XOKYHLNHXFSWDN-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 65.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.06 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze selanyl(1,3,5-triazin-2-yl)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of selanyl(1,3,5-triazin-2-yl)cyanamide?
The IUPAC name of selanyl(1,3,5-triazin-2-yl)cyanamide (CID 174991847) is selanyl(1,3,5-triazin-2-yl)cyanamide.
What is the SMILES notation for selanyl(1,3,5-triazin-2-yl)cyanamide?
The canonical SMILES for selanyl(1,3,5-triazin-2-yl)cyanamide is N#CN([SeH])c1ncncn1.
What is the InChIKey of selanyl(1,3,5-triazin-2-yl)cyanamide?
The InChIKey is XOKYHLNHXFSWDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N5Se/c5-1-9(10)4-7-2-6-3-8-4/h2-3,10H.
What are the key properties of selanyl(1,3,5-triazin-2-yl)cyanamide?
selanyl(1,3,5-triazin-2-yl)cyanamide has a molecular weight of 200.06 g/mol, XLogP of -1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for selanyl(1,3,5-triazin-2-yl)cyanamide is sourced from PubChem (CID 174991847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).