About 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol
4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol (PubChem CID 174991917) has the molecular formula C6H11O4P
and a molecular weight of 178.12 g/mol. Its IUPAC name is 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol.
Molecular Properties
| Compound Name | 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol |
| PubChem CID | 174991917 |
| Molecular Formula | C6H11O4P |
| Molecular Weight | 178.12 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol |
| SMILES | CC(O)=CCP1(=O)OCCO1 |
| InChI | InChI=1S/C6H11O4P/c1-6(7)2-5-11(8)9-3-4-10-11/h2,7H,3-5H2,1H3 |
| InChIKey | NAEYJLKIPLEJRN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.12 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol?
The IUPAC name of 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol (CID 174991917) is 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol.
What is the SMILES notation for 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol?
The canonical SMILES for 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol is CC(O)=CCP1(=O)OCCO1.
What is the InChIKey of 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol?
The InChIKey is NAEYJLKIPLEJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O4P/c1-6(7)2-5-11(8)9-3-4-10-11/h2,7H,3-5H2,1H3.
What are the key properties of 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol?
4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol has a molecular weight of 178.12 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)but-2-en-2-ol is sourced from PubChem (CID 174991917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).