About methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate
methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate (PubChem CID 174992892) has the molecular formula C7H6BrNO4
and a molecular weight of 248.03 g/mol. Its IUPAC name is methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate |
| PubChem CID | 174992892 |
| Molecular Formula | C7H6BrNO4 |
| Molecular Weight | 248.03 g/mol |
| Exact Mass | 246.95 |
| IUPAC Name | methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(C(Br)C=O)n1 |
| InChI | InChI=1S/C7H6BrNO4/c1-12-7(11)5-3-13-6(9-5)4(8)2-10/h2-4H,1H3 |
| InChIKey | JQUKZYDCPTYQCF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.03 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate (CID 174992892) is methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate is COC(=O)c1coc(C(Br)C=O)n1.
What is the InChIKey of methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate?
The InChIKey is JQUKZYDCPTYQCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO4/c1-12-7(11)5-3-13-6(9-5)4(8)2-10/h2-4H,1H3.
What are the key properties of methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate?
methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate has a molecular weight of 248.03 g/mol, XLogP of 1.10, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-bromo-2-oxoethyl)-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 174992892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).