About 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid
4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid (PubChem CID 174993136) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid |
| PubChem CID | 174993136 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid |
| SMILES | C1=NCCN1.O=C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C9H8O2.C3H6N2/c10-9(11)7-6-8-4-2-1-3-5-8;1-2-5-3-4-1/h1-7H,(H,10,11);3H,1-2H2,(H,4,5) |
| InChIKey | CXTGBEGILSCCJU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid?
The IUPAC name of 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid (CID 174993136) is 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid.
What is the SMILES notation for 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid?
The canonical SMILES for 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid is C1=NCCN1.O=C(O)C=Cc1ccccc1.
What is the InChIKey of 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid?
The InChIKey is CXTGBEGILSCCJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.C3H6N2/c10-9(11)7-6-8-4-2-1-3-5-8;1-2-5-3-4-1/h1-7H,(H,10,11);3H,1-2H2,(H,4,5).
What are the key properties of 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid?
4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid has a molecular weight of 218.26 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-imidazole;3-phenylprop-2-enoic acid is sourced from PubChem (CID 174993136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).