C7H12ClF3N2 — CID 174993248
3,3,3-trifluoro-N,N-dimethyl-2-(methyliminomethyl)prop-1-en-1-amine;hydrochloride (PubChem CID 174993248) has the molecular formula C7H12ClF3N2 and a molecular weight of 216.63 g/mol. Its IUPAC name is 3,3,3-trifluoro-N,N-dimethyl-2-(methyliminomethyl)prop-1-en-1-amine;hydrochloride.
| Compound Name | 3,3,3-trifluoro-N,N-dimethyl-2-(methyliminomethyl)prop-1-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 174993248 |
| Molecular Formula | C7H12ClF3N2 |
| Molecular Weight | 216.63 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 3,3,3-trifluoro-N,N-dimethyl-2-(methyliminomethyl)prop-1-en-1-amine;hydrochloride |
| SMILES | C/N=C/C(=CN(C)C)C(F)(F)F.Cl |
| InChI | InChI=1S/C7H11F3N2.ClH/c1-11-4-6(5-12(2)3)7(8,9)10;/h4-5H,1-3H3;1H/b6-5?,11-4+; |
| InChIKey | IUCKMLOASIVEDM-OSGIYJEFSA-N |
| XLogP | 2.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.63 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|