About 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile
4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile (PubChem CID 174994034) has the molecular formula C24H16N2O3
and a molecular weight of 380.40 g/mol. Its IUPAC name is 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile |
| PubChem CID | 174994034 |
| Molecular Formula | C24H16N2O3 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=C2OC(=O)N(Cc3ccccc3)C2=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H16N2O3/c25-15-17-11-13-20(14-12-17)21(19-9-5-2-6-10-19)22-23(27)26(24(28)29-22)16-18-7-3-1-4-8-18/h1-14H,16H2 |
| InChIKey | UJDXZOZWQYBBIJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile?
The IUPAC name of 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile (CID 174994034) is 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile.
What is the SMILES notation for 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile?
The canonical SMILES for 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile is N#Cc1ccc(C(=C2OC(=O)N(Cc3ccccc3)C2=O)c2ccccc2)cc1.
What is the InChIKey of 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile?
The InChIKey is UJDXZOZWQYBBIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16N2O3/c25-15-17-11-13-20(14-12-17)21(19-9-5-2-6-10-19)22-23(27)26(24(28)29-22)16-18-7-3-1-4-8-18/h1-14H,16H2.
What are the key properties of 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile?
4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile has a molecular weight of 380.40 g/mol, XLogP of 4.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-benzyl-2,4-dioxo-1,3-oxazolidin-5-ylidene)-phenylmethyl]benzonitrile is sourced from PubChem (CID 174994034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).