About sodium;ethyl octadecan-9-yloxy sulfate;hydride
sodium;ethyl octadecan-9-yloxy sulfate;hydride (PubChem CID 174994159) has the molecular formula C20H43NaO5S
and a molecular weight of 418.62 g/mol. Its IUPAC name is sodium;ethyl octadecan-9-yloxy sulfate;hydride.
Molecular Properties
| Compound Name | sodium;ethyl octadecan-9-yloxy sulfate;hydride |
| PubChem CID | 174994159 |
| Molecular Formula | C20H43NaO5S |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | sodium;ethyl octadecan-9-yloxy sulfate;hydride |
| SMILES | CCCCCCCCCC(CCCCCCCC)OOS(=O)(=O)OCC.[H-].[Na+] |
| InChI | InChI=1S/C20H42O5S.Na.H/c1-4-7-9-11-13-15-17-19-20(18-16-14-12-10-8-5-2)24-25-26(21,22)23-6-3;;/h20H,4-19H2,1-3H3;;/q;+1;-1 |
| InChIKey | COHJUUQFLHBKFG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethyl octadecan-9-yloxy sulfate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethyl octadecan-9-yloxy sulfate;hydride?
The IUPAC name of sodium;ethyl octadecan-9-yloxy sulfate;hydride (CID 174994159) is sodium;ethyl octadecan-9-yloxy sulfate;hydride.
What is the SMILES notation for sodium;ethyl octadecan-9-yloxy sulfate;hydride?
The canonical SMILES for sodium;ethyl octadecan-9-yloxy sulfate;hydride is CCCCCCCCCC(CCCCCCCC)OOS(=O)(=O)OCC.[H-].[Na+].
What is the InChIKey of sodium;ethyl octadecan-9-yloxy sulfate;hydride?
The InChIKey is COHJUUQFLHBKFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O5S.Na.H/c1-4-7-9-11-13-15-17-19-20(18-16-14-12-10-8-5-2)24-25-26(21,22)23-6-3;;/h20H,4-19H2,1-3H3;;/q;+1;-1.
What are the key properties of sodium;ethyl octadecan-9-yloxy sulfate;hydride?
sodium;ethyl octadecan-9-yloxy sulfate;hydride has a molecular weight of 418.62 g/mol, XLogP of 3.59, 20 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethyl octadecan-9-yloxy sulfate;hydride is sourced from PubChem (CID 174994159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).