C4H3F6NO3S — CID 174994277
1,1,1,3,3,3-hexafluoro-2-(sulfinocarbamoyl)propane (PubChem CID 174994277) has the molecular formula C4H3F6NO3S and a molecular weight of 259.13 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(sulfinocarbamoyl)propane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(sulfinocarbamoyl)propane |
|---|---|
| PubChem CID | 174994277 |
| Molecular Formula | C4H3F6NO3S |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(sulfinocarbamoyl)propane |
| SMILES | O=C(NS(=O)O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H3F6NO3S/c5-3(6,7)1(4(8,9)10)2(12)11-15(13)14/h1H,(H,11,12)(H,13,14) |
| InChIKey | YSKDHIVOIRJWQZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|