About N-propylprop-2-enamide;pyrrolidin-2-one
N-propylprop-2-enamide;pyrrolidin-2-one (PubChem CID 174994372) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is N-propylprop-2-enamide;pyrrolidin-2-one.
Molecular Properties
| Compound Name | N-propylprop-2-enamide;pyrrolidin-2-one |
| PubChem CID | 174994372 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N-propylprop-2-enamide;pyrrolidin-2-one |
| SMILES | C=CC(=O)NCCC.O=C1CCCN1 |
| InChI | InChI=1S/C6H11NO.C4H7NO/c1-3-5-7-6(8)4-2;6-4-2-1-3-5-4/h4H,2-3,5H2,1H3,(H,7,8);1-3H2,(H,5,6) |
| InChIKey | PGAPBKNQGGOAFT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-propylprop-2-enamide;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylprop-2-enamide;pyrrolidin-2-one?
The IUPAC name of N-propylprop-2-enamide;pyrrolidin-2-one (CID 174994372) is N-propylprop-2-enamide;pyrrolidin-2-one.
What is the SMILES notation for N-propylprop-2-enamide;pyrrolidin-2-one?
The canonical SMILES for N-propylprop-2-enamide;pyrrolidin-2-one is C=CC(=O)NCCC.O=C1CCCN1.
What is the InChIKey of N-propylprop-2-enamide;pyrrolidin-2-one?
The InChIKey is PGAPBKNQGGOAFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C4H7NO/c1-3-5-7-6(8)4-2;6-4-2-1-3-5-4/h4H,2-3,5H2,1H3,(H,7,8);1-3H2,(H,5,6).
What are the key properties of N-propylprop-2-enamide;pyrrolidin-2-one?
N-propylprop-2-enamide;pyrrolidin-2-one has a molecular weight of 198.27 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylprop-2-enamide;pyrrolidin-2-one is sourced from PubChem (CID 174994372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).