C18H27ClN2O3S — CID 174994554
tert-butyl 4-[2-[(5-chlorothiophene-2-carbonyl)amino]propyl]piperidine-1-carboxylate (PubChem CID 174994554) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is tert-butyl 4-[2-[(5-chlorothiophene-2-carbonyl)amino]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(5-chlorothiophene-2-carbonyl)amino]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174994554 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | tert-butyl 4-[2-[(5-chlorothiophene-2-carbonyl)amino]propyl]piperidine-1-carboxylate |
| SMILES | CC(CC1CCN(C(=O)OC(C)(C)C)CC1)NC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H27ClN2O3S/c1-12(20-16(22)14-5-6-15(19)25-14)11-13-7-9-21(10-8-13)17(23)24-18(2,3)4/h5-6,12-13H,7-11H2,1-4H3,(H,20,22) |
| InChIKey | PIZLHTWHHLMDAX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |