About 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine
10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine (PubChem CID 174994612) has the molecular formula C14H15ClN4
and a molecular weight of 274.76 g/mol. Its IUPAC name is 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine.
Molecular Properties
| Compound Name | 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine |
| PubChem CID | 174994612 |
| Molecular Formula | C14H15ClN4 |
| Molecular Weight | 274.76 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine |
| SMILES | CN(C)c1ccc2c(c1)N(Cl)c1cc(N)ccc1N2 |
| InChI | InChI=1S/C14H15ClN4/c1-18(2)10-4-6-12-14(8-10)19(15)13-7-9(16)3-5-11(13)17-12/h3-8,17H,16H2,1-2H3 |
| InChIKey | OXCQHABWGWZGDJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine?
The IUPAC name of 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine (CID 174994612) is 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine.
What is the SMILES notation for 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine?
The canonical SMILES for 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine is CN(C)c1ccc2c(c1)N(Cl)c1cc(N)ccc1N2.
What is the InChIKey of 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine?
The InChIKey is OXCQHABWGWZGDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN4/c1-18(2)10-4-6-12-14(8-10)19(15)13-7-9(16)3-5-11(13)17-12/h3-8,17H,16H2,1-2H3.
What are the key properties of 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine?
10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine has a molecular weight of 274.76 g/mol, XLogP of 3.68, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-chloro-2-N,2-N-dimethyl-5H-phenazine-2,8-diamine is sourced from PubChem (CID 174994612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).