About azane;2-bromo-1,1-dichloroethane
azane;2-bromo-1,1-dichloroethane (PubChem CID 174995593) has the molecular formula C2H6BrCl2N
and a molecular weight of 194.89 g/mol. Its IUPAC name is azane;2-bromo-1,1-dichloroethane.
Molecular Properties
| Compound Name | azane;2-bromo-1,1-dichloroethane |
| PubChem CID | 174995593 |
| Molecular Formula | C2H6BrCl2N |
| Molecular Weight | 194.89 g/mol |
| Exact Mass | 192.91 |
| IUPAC Name | azane;2-bromo-1,1-dichloroethane |
| SMILES | ClC(Cl)CBr.N |
| InChI | InChI=1S/C2H3BrCl2.H3N/c3-1-2(4)5;/h2H,1H2;1H3 |
| InChIKey | OKULVWARMJIKRK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.89 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;2-bromo-1,1-dichloroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-bromo-1,1-dichloroethane?
The IUPAC name of azane;2-bromo-1,1-dichloroethane (CID 174995593) is azane;2-bromo-1,1-dichloroethane.
What is the SMILES notation for azane;2-bromo-1,1-dichloroethane?
The canonical SMILES for azane;2-bromo-1,1-dichloroethane is ClC(Cl)CBr.N.
What is the InChIKey of azane;2-bromo-1,1-dichloroethane?
The InChIKey is OKULVWARMJIKRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3BrCl2.H3N/c3-1-2(4)5;/h2H,1H2;1H3.
What are the key properties of azane;2-bromo-1,1-dichloroethane?
azane;2-bromo-1,1-dichloroethane has a molecular weight of 194.89 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-bromo-1,1-dichloroethane is sourced from PubChem (CID 174995593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).