About 3,3-dimethylpyrrole;hydrochloride
3,3-dimethylpyrrole;hydrochloride (PubChem CID 174996377) has the molecular formula C6H10ClN
and a molecular weight of 131.61 g/mol. Its IUPAC name is 3,3-dimethylpyrrole;hydrochloride.
Molecular Properties
| Compound Name | 3,3-dimethylpyrrole;hydrochloride |
| PubChem CID | 174996377 |
| Molecular Formula | C6H10ClN |
| Molecular Weight | 131.61 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 3,3-dimethylpyrrole;hydrochloride |
| SMILES | CC1(C)C=CN=C1.Cl |
| InChI | InChI=1S/C6H9N.ClH/c1-6(2)3-4-7-5-6;/h3-5H,1-2H3;1H |
| InChIKey | MTGHIQJNOGNMLI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.61 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dimethylpyrrole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylpyrrole;hydrochloride?
The IUPAC name of 3,3-dimethylpyrrole;hydrochloride (CID 174996377) is 3,3-dimethylpyrrole;hydrochloride.
What is the SMILES notation for 3,3-dimethylpyrrole;hydrochloride?
The canonical SMILES for 3,3-dimethylpyrrole;hydrochloride is CC1(C)C=CN=C1.Cl.
What is the InChIKey of 3,3-dimethylpyrrole;hydrochloride?
The InChIKey is MTGHIQJNOGNMLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.ClH/c1-6(2)3-4-7-5-6;/h3-5H,1-2H3;1H.
What are the key properties of 3,3-dimethylpyrrole;hydrochloride?
3,3-dimethylpyrrole;hydrochloride has a molecular weight of 131.61 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylpyrrole;hydrochloride is sourced from PubChem (CID 174996377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).