About 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine
2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine (PubChem CID 174996449) has the molecular formula C16H29NO4
and a molecular weight of 299.41 g/mol. Its IUPAC name is 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine.
Molecular Properties
| Compound Name | 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine |
| PubChem CID | 174996449 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine |
| SMILES | C1CC(CC2CO2)C(CC2CO2)CC1OCC1CO1.CN |
| InChI | InChI=1S/C15H24O4.CH5N/c1-2-12(16-8-15-9-19-15)4-11(5-14-7-18-14)10(1)3-13-6-17-13;1-2/h10-15H,1-9H2;2H2,1H3 |
| InChIKey | WWLRIRLBQOOMKA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine?
The IUPAC name of 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine (CID 174996449) is 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine.
What is the SMILES notation for 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine?
The canonical SMILES for 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine is C1CC(CC2CO2)C(CC2CO2)CC1OCC1CO1.CN.
What is the InChIKey of 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine?
The InChIKey is WWLRIRLBQOOMKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4.CH5N/c1-2-12(16-8-15-9-19-15)4-11(5-14-7-18-14)10(1)3-13-6-17-13;1-2/h10-15H,1-9H2;2H2,1H3.
What are the key properties of 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine?
2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine has a molecular weight of 299.41 g/mol, XLogP of 1.34, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,4-bis(oxiran-2-ylmethyl)cyclohexyl]oxymethyl]oxirane;methanamine is sourced from PubChem (CID 174996449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).