About [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol
[3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol (PubChem CID 174996615) has the molecular formula C19H14F5NOS
and a molecular weight of 399.38 g/mol. Its IUPAC name is [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol.
Molecular Properties
| Compound Name | [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol |
| PubChem CID | 174996615 |
| Molecular Formula | C19H14F5NOS |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol |
| SMILES | CC(F)(F)c1ccc(-c2ccc(-c3nsc(C(F)(F)F)c3CO)cc2)cc1 |
| InChI | InChI=1S/C19H14F5NOS/c1-18(20,21)14-8-6-12(7-9-14)11-2-4-13(5-3-11)16-15(10-26)17(27-25-16)19(22,23)24/h2-9,26H,10H2,1H3 |
| InChIKey | WPXGKSXTJPHLAY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol?
The IUPAC name of [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol (CID 174996615) is [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol.
What is the SMILES notation for [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol?
The canonical SMILES for [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol is CC(F)(F)c1ccc(-c2ccc(-c3nsc(C(F)(F)F)c3CO)cc2)cc1.
What is the InChIKey of [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol?
The InChIKey is WPXGKSXTJPHLAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F5NOS/c1-18(20,21)14-8-6-12(7-9-14)11-2-4-13(5-3-11)16-15(10-26)17(27-25-16)19(22,23)24/h2-9,26H,10H2,1H3.
What are the key properties of [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol?
[3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol has a molecular weight of 399.38 g/mol, XLogP of 6.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-[4-(1,1-difluoroethyl)phenyl]phenyl]-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanol is sourced from PubChem (CID 174996615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).