methyl (3-ethyloxetan-3-yl)methanesulfonate

C7H14O4S — CID 174996900

IUPACmethyl (3-ethyloxetan-3-yl)methanesulfonate
SMILESCCC1(CS(=O)(=O)OC)COC1
InChIInChI=1S/C7H14O4S/c1-3-7(4-11-5-7)6-12(8,9)10-2/h3-6H2,1-2H3
InChIKeyASPXPIZHLTYSNR-UHFFFAOYSA-N
MW194.25 g/mol
LogP0.39
Rot. Bonds4

About methyl (3-ethyloxetan-3-yl)methanesulfonate

methyl (3-ethyloxetan-3-yl)methanesulfonate (PubChem CID 174996900) has the molecular formula C7H14O4S and a molecular weight of 194.25 g/mol. Its IUPAC name is methyl (3-ethyloxetan-3-yl)methanesulfonate.

Molecular Properties

Compound Namemethyl (3-ethyloxetan-3-yl)methanesulfonate
PubChem CID174996900
Molecular FormulaC7H14O4S
Molecular Weight194.25 g/mol
Exact Mass194.06
IUPAC Namemethyl (3-ethyloxetan-3-yl)methanesulfonate
SMILESCCC1(CS(=O)(=O)OC)COC1
InChIInChI=1S/C7H14O4S/c1-3-7(4-11-5-7)6-12(8,9)10-2/h3-6H2,1-2H3
InChIKeyASPXPIZHLTYSNR-UHFFFAOYSA-N
XLogP0.39
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.25
LogP ≤ 50.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze methyl (3-ethyloxetan-3-yl)methanesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3-ethyloxetan-3-yl)methanesulfonate?
The IUPAC name of methyl (3-ethyloxetan-3-yl)methanesulfonate (CID 174996900) is methyl (3-ethyloxetan-3-yl)methanesulfonate.
What is the SMILES notation for methyl (3-ethyloxetan-3-yl)methanesulfonate?
The canonical SMILES for methyl (3-ethyloxetan-3-yl)methanesulfonate is CCC1(CS(=O)(=O)OC)COC1.
What is the InChIKey of methyl (3-ethyloxetan-3-yl)methanesulfonate?
The InChIKey is ASPXPIZHLTYSNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4S/c1-3-7(4-11-5-7)6-12(8,9)10-2/h3-6H2,1-2H3.
What are the key properties of methyl (3-ethyloxetan-3-yl)methanesulfonate?
methyl (3-ethyloxetan-3-yl)methanesulfonate has a molecular weight of 194.25 g/mol, XLogP of 0.39, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3-ethyloxetan-3-yl)methanesulfonate is sourced from PubChem (CID 174996900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).