C9H22KO4P — CID 174996934
potassium;2,6-dimethylheptan-4-yl dihydrogen phosphate;hydride (PubChem CID 174996934) has the molecular formula C9H22KO4P and a molecular weight of 264.34 g/mol. Its IUPAC name is potassium;2,6-dimethylheptan-4-yl dihydrogen phosphate;hydride.
| Compound Name | potassium;2,6-dimethylheptan-4-yl dihydrogen phosphate;hydride |
|---|---|
| PubChem CID | 174996934 |
| Molecular Formula | C9H22KO4P |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | potassium;2,6-dimethylheptan-4-yl dihydrogen phosphate;hydride |
| SMILES | CC(C)CC(CC(C)C)OP(=O)(O)O.[H-].[K+] |
| InChI | InChI=1S/C9H21O4P.K.H/c1-7(2)5-9(6-8(3)4)13-14(10,11)12;;/h7-9H,5-6H2,1-4H3,(H2,10,11,12);;/q;+1;-1 |
| InChIKey | HQINLLDTGPHUAY-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|