About 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide
1-benzyl-3-phenyl-2H-imidazole;dihydrobromide (PubChem CID 174997401) has the molecular formula C16H18Br2N2
and a molecular weight of 398.14 g/mol. Its IUPAC name is 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide.
Molecular Properties
| Compound Name | 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide |
| PubChem CID | 174997401 |
| Molecular Formula | C16H18Br2N2 |
| Molecular Weight | 398.14 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide |
| SMILES | Br.Br.C1=CN(c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C16H16N2.2BrH/c1-3-7-15(8-4-1)13-17-11-12-18(14-17)16-9-5-2-6-10-16;;/h1-12H,13-14H2;2*1H |
| InChIKey | FBIVJMGTRFHZMD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.14 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide?
The IUPAC name of 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide (CID 174997401) is 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide.
What is the SMILES notation for 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide?
The canonical SMILES for 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide is Br.Br.C1=CN(c2ccccc2)CN1Cc1ccccc1.
What is the InChIKey of 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide?
The InChIKey is FBIVJMGTRFHZMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2.2BrH/c1-3-7-15(8-4-1)13-17-11-12-18(14-17)16-9-5-2-6-10-16;;/h1-12H,13-14H2;2*1H.
What are the key properties of 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide?
1-benzyl-3-phenyl-2H-imidazole;dihydrobromide has a molecular weight of 398.14 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-phenyl-2H-imidazole;dihydrobromide is sourced from PubChem (CID 174997401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).