About ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone
ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 174997857) has the molecular formula C28H30N2O3
and a molecular weight of 442.56 g/mol. Its IUPAC name is ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone |
| PubChem CID | 174997857 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | CC(=O)C1(c2ccccc2)C=CC=CC1.CCOC(=O)CN1C=CC(c2ccncc2)=CC1 |
| InChI | InChI=1S/C14H16N2O2.C14H14O/c1-2-18-14(17)11-16-9-5-13(6-10-16)12-3-7-15-8-4-12;1-12(15)14(10-6-3-7-11-14)13-8-4-2-5-9-13/h3-9H,2,10-11H2,1H3;2-10H,11H2,1H3 |
| InChIKey | VQPUMWWJLZRSBZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone?
The IUPAC name of ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone (CID 174997857) is ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone.
What is the SMILES notation for ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone?
The canonical SMILES for ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone is CC(=O)C1(c2ccccc2)C=CC=CC1.CCOC(=O)CN1C=CC(c2ccncc2)=CC1.
What is the InChIKey of ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone?
The InChIKey is VQPUMWWJLZRSBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2.C14H14O/c1-2-18-14(17)11-16-9-5-13(6-10-16)12-3-7-15-8-4-12;1-12(15)14(10-6-3-7-11-14)13-8-4-2-5-9-13/h3-9H,2,10-11H2,1H3;2-10H,11H2,1H3.
What are the key properties of ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone?
ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone has a molecular weight of 442.56 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-pyridin-4-yl-2H-pyridin-1-yl)acetate;1-(1-phenylcyclohexa-2,4-dien-1-yl)ethanone is sourced from PubChem (CID 174997857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).