About spiro[1,3-dihydroindole-2,3'-dioxirane]
spiro[1,3-dihydroindole-2,3'-dioxirane] (PubChem CID 174997993) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is spiro[1,3-dihydroindole-2,3'-dioxirane].
Molecular Properties
| Compound Name | spiro[1,3-dihydroindole-2,3'-dioxirane] |
| PubChem CID | 174997993 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | spiro[1,3-dihydroindole-2,3'-dioxirane] |
| SMILES | c1ccc2c(c1)CC1(N2)OO1 |
| InChI | InChI=1S/C8H7NO2/c1-2-4-7-6(3-1)5-8(9-7)10-11-8/h1-4,9H,5H2 |
| InChIKey | DCEYQEMTUCPGOX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 37.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dihydroindole-2,3'-dioxirane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dihydroindole-2,3'-dioxirane]?
The IUPAC name of spiro[1,3-dihydroindole-2,3'-dioxirane] (CID 174997993) is spiro[1,3-dihydroindole-2,3'-dioxirane].
What is the SMILES notation for spiro[1,3-dihydroindole-2,3'-dioxirane]?
The canonical SMILES for spiro[1,3-dihydroindole-2,3'-dioxirane] is c1ccc2c(c1)CC1(N2)OO1.
What is the InChIKey of spiro[1,3-dihydroindole-2,3'-dioxirane]?
The InChIKey is DCEYQEMTUCPGOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c1-2-4-7-6(3-1)5-8(9-7)10-11-8/h1-4,9H,5H2.
What are the key properties of spiro[1,3-dihydroindole-2,3'-dioxirane]?
spiro[1,3-dihydroindole-2,3'-dioxirane] has a molecular weight of 149.15 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dihydroindole-2,3'-dioxirane] is sourced from PubChem (CID 174997993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).