C47H34N4 — CID 174998207
8,10,12-trimethyl-2,3,5,7-tetraphenylporphyrin (PubChem CID 174998207) has the molecular formula C47H34N4 and a molecular weight of 654.82 g/mol. Its IUPAC name is 8,10,12-trimethyl-2,3,5,7-tetraphenylporphyrin.
| Compound Name | 8,10,12-trimethyl-2,3,5,7-tetraphenylporphyrin |
|---|---|
| PubChem CID | 174998207 |
| Molecular Formula | C47H34N4 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 8,10,12-trimethyl-2,3,5,7-tetraphenylporphyrin |
| SMILES | CC1=CC2=N/C1=C(/C)C1=N/C(=C(/c3ccccc3)C3=N/C(=C\C4=N/C(=C\2)C=C4)C(c2ccccc2)=C3c2ccccc2)C(c2ccccc2)=C1C |
| InChI | InChI=1S/C47H34N4/c1-29-26-38-27-36-24-25-37(48-36)28-39-41(33-18-10-5-11-19-33)42(34-20-12-6-13-21-34)47(50-39)43(35-22-14-7-15-23-35)46-40(32-16-8-4-9-17-32)30(2)45(51-46)31(3)44(29)49-38/h4-28H,1-3H3/b36-27-,37-28-,38-27-,39-28-,44-31-,45-31-,46-43-,47-43- |
| InChIKey | VYEWKBISWQPOLW-COMSWCMDSA-N |
| XLogP | 10.86 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|