About 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride
2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride (PubChem CID 174998407) has the molecular formula C5H16ClNOPb
and a molecular weight of 348.84 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride.
Molecular Properties
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride |
| PubChem CID | 174998407 |
| Molecular Formula | C5H16ClNOPb |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride |
| SMILES | C[N+](C)(C)CCO.[Cl-].[PbH2] |
| InChI | InChI=1S/C5H14NO.ClH.Pb.2H/c1-6(2,3)4-5-7;;;;/h7H,4-5H2,1-3H3;1H;;;/q+1;;;;/p-1 |
| InChIKey | AHXIHYSXTFHBKX-UHFFFAOYSA-M |
| XLogP | -4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | -4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride?
The IUPAC name of 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride (CID 174998407) is 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride.
What is the SMILES notation for 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride?
The canonical SMILES for 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride is C[N+](C)(C)CCO.[Cl-].[PbH2].
What is the InChIKey of 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride?
The InChIKey is AHXIHYSXTFHBKX-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H14NO.ClH.Pb.2H/c1-6(2,3)4-5-7;;;;/h7H,4-5H2,1-3H3;1H;;;/q+1;;;;/p-1.
What are the key properties of 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride?
2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride has a molecular weight of 348.84 g/mol, XLogP of -4.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl(trimethyl)azanium;λ2-plumbane;chloride is sourced from PubChem (CID 174998407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).