C24H28N2O3S — CID 174999205
2,4-dimethylbenzenesulfonic acid;N,N-dimethyl-4-[2-(2-methyl-4-pyridinyl)ethenyl]aniline (PubChem CID 174999205) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 2,4-dimethylbenzenesulfonic acid;N,N-dimethyl-4-[2-(2-methyl-4-pyridinyl)ethenyl]aniline.
| Compound Name | 2,4-dimethylbenzenesulfonic acid;N,N-dimethyl-4-[2-(2-methyl-4-pyridinyl)ethenyl]aniline |
|---|---|
| PubChem CID | 174999205 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2,4-dimethylbenzenesulfonic acid;N,N-dimethyl-4-[2-(2-methyl-4-pyridinyl)ethenyl]aniline |
| SMILES | Cc1cc(C=Cc2ccc(N(C)C)cc2)ccn1.Cc1ccc(S(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C16H18N2.C8H10O3S/c1-13-12-15(10-11-17-13)5-4-14-6-8-16(9-7-14)18(2)3;1-6-3-4-8(7(2)5-6)12(9,10)11/h4-12H,1-3H3;3-5H,1-2H3,(H,9,10,11) |
| InChIKey | NWNJBAREGBKDSG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|