C15H13F3N2O3 — CID 174999413
3-[[methyl-[6-oxo-2-(trifluoromethyl)-1H-pyridin-3-yl]amino]methyl]benzoic acid (PubChem CID 174999413) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is 3-[[methyl-[6-oxo-2-(trifluoromethyl)-1H-pyridin-3-yl]amino]methyl]benzoic acid.
| Compound Name | 3-[[methyl-[6-oxo-2-(trifluoromethyl)-1H-pyridin-3-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 174999413 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-[[methyl-[6-oxo-2-(trifluoromethyl)-1H-pyridin-3-yl]amino]methyl]benzoic acid |
| SMILES | CN(Cc1cccc(C(=O)O)c1)c1ccc(=O)[nH]c1C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O3/c1-20(8-9-3-2-4-10(7-9)14(22)23)11-5-6-12(21)19-13(11)15(16,17)18/h2-7H,8H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | LIPXQBLRYVEMNT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |